C15H30N2O — CID 58801021
3-(3-methyl-2-propan-2-ylbut-2-enyl)-1,1-di(propan-2-yl)urea (PubChem CID 58801021) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 3-(3-methyl-2-propan-2-ylbut-2-enyl)-1,1-di(propan-2-yl)urea.
| Compound Name | 3-(3-methyl-2-propan-2-ylbut-2-enyl)-1,1-di(propan-2-yl)urea |
|---|---|
| PubChem CID | 58801021 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 3-(3-methyl-2-propan-2-ylbut-2-enyl)-1,1-di(propan-2-yl)urea |
| SMILES | CC(C)=C(CNC(=O)N(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C15H30N2O/c1-10(2)14(11(3)4)9-16-15(18)17(12(5)6)13(7)8/h10,12-13H,9H2,1-8H3,(H,16,18) |
| InChIKey | LZRWZYLVIGFLSK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|