C24H50N4O2 — CID 3090457
1,1-di(butan-2-yl)-3-[6-[di(butan-2-yl)carbamoylamino]hexyl]urea (PubChem CID 3090457) has the molecular formula C24H50N4O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is 1,1-di(butan-2-yl)-3-[6-[di(butan-2-yl)carbamoylamino]hexyl]urea.
| Compound Name | 1,1-di(butan-2-yl)-3-[6-[di(butan-2-yl)carbamoylamino]hexyl]urea |
|---|---|
| PubChem CID | 3090457 |
| Molecular Formula | C24H50N4O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 1,1-di(butan-2-yl)-3-[6-[di(butan-2-yl)carbamoylamino]hexyl]urea |
| SMILES | CCC(C)N(C(=O)NCCCCCCNC(=O)N(C(C)CC)C(C)CC)C(C)CC |
| InChI | InChI=1S/C24H50N4O2/c1-9-19(5)27(20(6)10-2)23(29)25-17-15-13-14-16-18-26-24(30)28(21(7)11-3)22(8)12-4/h19-22H,9-18H2,1-8H3,(H,25,29)(H,26,30) |
| InChIKey | IKUIGTIMDRBBOP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|