C18H31NO2 — CID 134906539
4-(1-hydroxy-2,2-dimethylpropyl)-N,N-di(propan-2-yl)cyclohexa-2,5-diene-1-carboxamide (PubChem CID 134906539) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 4-(1-hydroxy-2,2-dimethylpropyl)-N,N-di(propan-2-yl)cyclohexa-2,5-diene-1-carboxamide.
| Compound Name | 4-(1-hydroxy-2,2-dimethylpropyl)-N,N-di(propan-2-yl)cyclohexa-2,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 134906539 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 4-(1-hydroxy-2,2-dimethylpropyl)-N,N-di(propan-2-yl)cyclohexa-2,5-diene-1-carboxamide |
| SMILES | CC(C)N(C(=O)C1C=CC(C(O)C(C)(C)C)C=C1)C(C)C |
| InChI | InChI=1S/C18H31NO2/c1-12(2)19(13(3)4)17(21)15-10-8-14(9-11-15)16(20)18(5,6)7/h8-16,20H,1-7H3 |
| InChIKey | ZGHKZEVFBJBHRV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|