C11H19NO2 — CID 10535936
N,N-di(propan-2-yl)-2,5-dihydrofuran-2-carboxamide (PubChem CID 10535936) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-2,5-dihydrofuran-2-carboxamide.
| Compound Name | N,N-di(propan-2-yl)-2,5-dihydrofuran-2-carboxamide |
|---|---|
| PubChem CID | 10535936 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N,N-di(propan-2-yl)-2,5-dihydrofuran-2-carboxamide |
| SMILES | CC(C)N(C(=O)C1C=CCO1)C(C)C |
| InChI | InChI=1S/C11H19NO2/c1-8(2)12(9(3)4)11(13)10-6-5-7-14-10/h5-6,8-10H,7H2,1-4H3 |
| InChIKey | VXNDWJIKKNOFQX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|