About (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid
(2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid (PubChem CID 46188742) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid |
| PubChem CID | 46188742 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid |
| SMILES | N[C@H](C(=O)O)[C@@H]1C=CCO1 |
| InChI | InChI=1S/C6H9NO3/c7-5(6(8)9)4-2-1-3-10-4/h1-2,4-5H,3,7H2,(H,8,9)/t4-,5-/m0/s1 |
| InChIKey | PACBOIYQPQYGQE-WHFBIAKZSA-N |
| XLogP | -0.65 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid?
The IUPAC name of (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid (CID 46188742) is (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid.
What is the SMILES notation for (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid?
The canonical SMILES for (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid is N[C@H](C(=O)O)[C@@H]1C=CCO1.
What is the InChIKey of (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid?
The InChIKey is PACBOIYQPQYGQE-WHFBIAKZSA-N. The full InChI is InChI=1S/C6H9NO3/c7-5(6(8)9)4-2-1-3-10-4/h1-2,4-5H,3,7H2,(H,8,9)/t4-,5-/m0/s1.
What are the key properties of (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid?
(2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid has a molecular weight of 143.14 g/mol, XLogP of -0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-[(2S)-2,5-dihydrofuran-2-yl]acetic acid is sourced from PubChem (CID 46188742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).