C15H17F2NO3 — CID 67049065
benzyl-[(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropyl]carbamic acid (PubChem CID 67049065) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is benzyl-[(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropyl]carbamic acid.
| Compound Name | benzyl-[(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropyl]carbamic acid |
|---|---|
| PubChem CID | 67049065 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | benzyl-[(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropyl]carbamic acid |
| SMILES | O=C(O)N(Cc1ccccc1)C[C@H](C(F)F)[C@@H]1C=CCO1 |
| InChI | InChI=1S/C15H17F2NO3/c16-14(17)12(13-7-4-8-21-13)10-18(15(19)20)9-11-5-2-1-3-6-11/h1-7,12-14H,8-10H2,(H,19,20)/t12-,13-/m0/s1 |
| InChIKey | GECOBRGZBQFXRC-STQMWFEESA-N |
| XLogP | 3.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|