C16H31NO3 — CID 101418704
[(Z,3S,4S)-4-hydroxy-3,5,5-trimethylhex-1-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 101418704) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is [(Z,3S,4S)-4-hydroxy-3,5,5-trimethylhex-1-enyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z,3S,4S)-4-hydroxy-3,5,5-trimethylhex-1-enyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 101418704 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | [(Z,3S,4S)-4-hydroxy-3,5,5-trimethylhex-1-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O/C=C\[C@H](C)[C@H](O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H31NO3/c1-11(2)17(12(3)4)15(19)20-10-9-13(5)14(18)16(6,7)8/h9-14,18H,1-8H3/b10-9-/t13-,14-/m0/s1 |
| InChIKey | IDGJYSMBLMOLBY-YHFBFXLGSA-N |
| XLogP | 3.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|