C17H35NO3Si — CID 135050712
[(E,3R,4S)-4-hydroxy-5-methyl-3-trimethylsilylhex-1-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 135050712) has the molecular formula C17H35NO3Si and a molecular weight of 329.56 g/mol. Its IUPAC name is [(E,3R,4S)-4-hydroxy-5-methyl-3-trimethylsilylhex-1-enyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(E,3R,4S)-4-hydroxy-5-methyl-3-trimethylsilylhex-1-enyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 135050712 |
| Molecular Formula | C17H35NO3Si |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | [(E,3R,4S)-4-hydroxy-5-methyl-3-trimethylsilylhex-1-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)[C@H](O)[C@@H](/C=C/OC(=O)N(C(C)C)C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H35NO3Si/c1-12(2)16(19)15(22(7,8)9)10-11-21-17(20)18(13(3)4)14(5)6/h10-16,19H,1-9H3/b11-10+/t15-,16+/m1/s1 |
| InChIKey | QMHYBHUYYODASD-PCCNWKQFSA-N |
| XLogP | 4.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|