C36H48N2O3Si — CID 12066981
[(4S,5S)-5-(dibenzylamino)-4-hydroxy-6-phenyl-3-trimethylsilylhexa-1,2-dienyl] N,N-di(propan-2-yl)carbamate (PubChem CID 12066981) has the molecular formula C36H48N2O3Si and a molecular weight of 584.88 g/mol. Its IUPAC name is [(4S,5S)-5-(dibenzylamino)-4-hydroxy-6-phenyl-3-trimethylsilylhexa-1,2-dienyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(4S,5S)-5-(dibenzylamino)-4-hydroxy-6-phenyl-3-trimethylsilylhexa-1,2-dienyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 12066981 |
| Molecular Formula | C36H48N2O3Si |
| Molecular Weight | 584.88 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | [(4S,5S)-5-(dibenzylamino)-4-hydroxy-6-phenyl-3-trimethylsilylhexa-1,2-dienyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)OC=C=C([C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C36H48N2O3Si/c1-28(2)38(29(3)4)36(40)41-24-23-34(42(5,6)7)35(39)33(25-30-17-11-8-12-18-30)37(26-31-19-13-9-14-20-31)27-32-21-15-10-16-22-32/h8-22,24,28-29,33,35,39H,25-27H2,1-7H3/t23?,33-,35-/m0/s1 |
| InChIKey | DYVWBCGJYQYBIS-XDXUOKHXSA-N |
| XLogP | 7.83 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.88 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|