C19H31NO2Si — CID 101343522
[(Z)-3-phenyl-1-trimethylsilylprop-1-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 101343522) has the molecular formula C19H31NO2Si and a molecular weight of 333.55 g/mol. Its IUPAC name is [(Z)-3-phenyl-1-trimethylsilylprop-1-enyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z)-3-phenyl-1-trimethylsilylprop-1-enyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 101343522 |
| Molecular Formula | C19H31NO2Si |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | [(Z)-3-phenyl-1-trimethylsilylprop-1-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O/C(=C/Cc1ccccc1)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C19H31NO2Si/c1-15(2)20(16(3)4)19(21)22-18(23(5,6)7)14-13-17-11-9-8-10-12-17/h8-12,14-16H,13H2,1-7H3/b18-14- |
| InChIKey | ATTQOAXAVHHSBG-JXAWBTAJSA-N |
| XLogP | 5.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|