C29H32N3O2- — CID 57364394
N-tert-butyl-N-[1-cyano-2-(dibenzylamino)-3-phenylpropyl]carbamate (PubChem CID 57364394) has the molecular formula C29H32N3O2- and a molecular weight of 454.59 g/mol. Its IUPAC name is N-tert-butyl-N-[1-cyano-2-(dibenzylamino)-3-phenylpropyl]carbamate.
| Compound Name | N-tert-butyl-N-[1-cyano-2-(dibenzylamino)-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 57364394 |
| Molecular Formula | C29H32N3O2- |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | N-tert-butyl-N-[1-cyano-2-(dibenzylamino)-3-phenylpropyl]carbamate |
| SMILES | CC(C)(C)N(C(=O)[O-])C(C#N)C(Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H33N3O2/c1-29(2,3)32(28(33)34)27(20-30)26(19-23-13-7-4-8-14-23)31(21-24-15-9-5-10-16-24)22-25-17-11-6-12-18-25/h4-18,26-27H,19,21-22H2,1-3H3,(H,33,34)/p-1 |
| InChIKey | FDLLCRGDWHEPHY-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |