C48H49AcN3O4 — CID 161029235
actinium;3-(dibenzylamino)-2-hydroxy-4-phenylbutanenitrile;3-(dibenzylamino)-2-hydroxy-4-phenylbutanoic acid (PubChem CID 161029235) has the molecular formula C48H49AcN3O4 and a molecular weight of 958.94 g/mol. Its IUPAC name is actinium;3-(dibenzylamino)-2-hydroxy-4-phenylbutanenitrile;3-(dibenzylamino)-2-hydroxy-4-phenylbutanoic acid.
| Compound Name | actinium;3-(dibenzylamino)-2-hydroxy-4-phenylbutanenitrile;3-(dibenzylamino)-2-hydroxy-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 161029235 |
| Molecular Formula | C48H49AcN3O4 |
| Molecular Weight | 958.94 g/mol |
| Exact Mass | 958.40 |
| IUPAC Name | actinium;3-(dibenzylamino)-2-hydroxy-4-phenylbutanenitrile;3-(dibenzylamino)-2-hydroxy-4-phenylbutanoic acid |
| SMILES | N#CC(O)C(Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1.O=C(O)C(O)C(Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1.[Ac] |
| InChI | InChI=1S/C24H24N2O.C24H25NO3.Ac/c25-17-24(27)23(16-20-10-4-1-5-11-20)26(18-21-12-6-2-7-13-21)19-22-14-8-3-9-15-22;26-23(24(27)28)22(16-19-10-4-1-5-11-19)25(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;/h1-15,23-24,27H,16,18-19H2;1-15,22-23,26H,16-18H2,(H,27,28); |
| InChIKey | FFONRNIZTXHYGI-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.94 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|