C26H27NO4 — CID 22880944
(2S,3S)-2-acetyloxy-3-(dibenzylamino)-4-phenylbutanoic acid (PubChem CID 22880944) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2S,3S)-2-acetyloxy-3-(dibenzylamino)-4-phenylbutanoic acid.
| Compound Name | (2S,3S)-2-acetyloxy-3-(dibenzylamino)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 22880944 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2S,3S)-2-acetyloxy-3-(dibenzylamino)-4-phenylbutanoic acid |
| SMILES | CC(=O)O[C@H](C(=O)O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H27NO4/c1-20(28)31-25(26(29)30)24(17-21-11-5-2-6-12-21)27(18-22-13-7-3-8-14-22)19-23-15-9-4-10-16-23/h2-16,24-25H,17-19H2,1H3,(H,29,30)/t24-,25-/m0/s1 |
| InChIKey | XCFFPOKYWWAQIM-DQEYMECFSA-N |
| XLogP | 4.32 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |