C23H30INO2 — CID 10624516
[(2S,3S)-3-(dibenzylamino)-1-iodo-5-methylhexan-2-yl] acetate (PubChem CID 10624516) has the molecular formula C23H30INO2 and a molecular weight of 479.40 g/mol. Its IUPAC name is [(2S,3S)-3-(dibenzylamino)-1-iodo-5-methylhexan-2-yl] acetate.
| Compound Name | [(2S,3S)-3-(dibenzylamino)-1-iodo-5-methylhexan-2-yl] acetate |
|---|---|
| PubChem CID | 10624516 |
| Molecular Formula | C23H30INO2 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | [(2S,3S)-3-(dibenzylamino)-1-iodo-5-methylhexan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](CI)[C@H](CC(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H30INO2/c1-18(2)14-22(23(15-24)27-19(3)26)25(16-20-10-6-4-7-11-20)17-21-12-8-5-9-13-21/h4-13,18,22-23H,14-17H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | DXQMHBAIXNTVFK-XZOQPEGZSA-N |
| XLogP | 5.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|