C28H33NO — CID 102427916
(E,3S,4S)-4-(dibenzylamino)-6-methyl-1-phenylhept-1-en-3-ol (PubChem CID 102427916) has the molecular formula C28H33NO and a molecular weight of 399.58 g/mol. Its IUPAC name is (E,3S,4S)-4-(dibenzylamino)-6-methyl-1-phenylhept-1-en-3-ol.
| Compound Name | (E,3S,4S)-4-(dibenzylamino)-6-methyl-1-phenylhept-1-en-3-ol |
|---|---|
| PubChem CID | 102427916 |
| Molecular Formula | C28H33NO |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (E,3S,4S)-4-(dibenzylamino)-6-methyl-1-phenylhept-1-en-3-ol |
| SMILES | CC(C)C[C@@H]([C@@H](O)/C=C/c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H33NO/c1-23(2)20-27(28(30)19-18-24-12-6-3-7-13-24)29(21-25-14-8-4-9-15-25)22-26-16-10-5-11-17-26/h3-19,23,27-28,30H,20-22H2,1-2H3/b19-18+/t27-,28-/m0/s1 |
| InChIKey | AGFWRAWBZXDVQA-JTTKXWLOSA-N |
| XLogP | 6.18 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |