C24H23NO2 — CID 138982111
(E,2S)-N,N-dibenzyl-2-hydroxy-4-phenylbut-3-enamide (PubChem CID 138982111) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is (E,2S)-N,N-dibenzyl-2-hydroxy-4-phenylbut-3-enamide.
| Compound Name | (E,2S)-N,N-dibenzyl-2-hydroxy-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 138982111 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (E,2S)-N,N-dibenzyl-2-hydroxy-4-phenylbut-3-enamide |
| SMILES | O=C([C@@H](O)/C=C/c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H23NO2/c26-23(17-16-20-10-4-1-5-11-20)24(27)25(18-21-12-6-2-7-13-21)19-22-14-8-3-9-15-22/h1-17,23,26H,18-19H2/b17-16+/t23-/m0/s1 |
| InChIKey | KUJDVMXAIUTGEL-OFYULWLWSA-N |
| XLogP | 4.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |