C21H43NO4Si — CID 11003928
[(Z,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3-methylhex-1-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 11003928) has the molecular formula C21H43NO4Si and a molecular weight of 401.66 g/mol. Its IUPAC name is [(Z,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3-methylhex-1-enyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3-methylhex-1-enyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 11003928 |
| Molecular Formula | C21H43NO4Si |
| Molecular Weight | 401.66 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | [(Z,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3-methylhex-1-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CO[C@H]([C@H](C)O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C\OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C21H43NO4Si/c1-15(2)22(16(3)4)20(23)25-14-13-17(5)19(24-10)18(6)26-27(11,12)21(7,8)9/h13-19H,1-12H3/b14-13-/t17-,18-,19-/m0/s1 |
| InChIKey | JMOGDRYVZABCNH-YYVKSZEZSA-N |
| XLogP | 5.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|