C24H49NO3Si — CID 11133718
[(Z,3S,4R)-3,5-dimethyl-4-tri(propan-2-yl)silyloxyhex-1-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 11133718) has the molecular formula C24H49NO3Si and a molecular weight of 427.75 g/mol. Its IUPAC name is [(Z,3S,4R)-3,5-dimethyl-4-tri(propan-2-yl)silyloxyhex-1-enyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z,3S,4R)-3,5-dimethyl-4-tri(propan-2-yl)silyloxyhex-1-enyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 11133718 |
| Molecular Formula | C24H49NO3Si |
| Molecular Weight | 427.75 g/mol |
| Exact Mass | 427.35 |
| IUPAC Name | [(Z,3S,4R)-3,5-dimethyl-4-tri(propan-2-yl)silyloxyhex-1-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)/C=C\OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C24H49NO3Si/c1-16(2)23(28-29(19(7)8,20(9)10)21(11)12)22(13)14-15-27-24(26)25(17(3)4)18(5)6/h14-23H,1-13H3/b15-14-/t22-,23+/m0/s1 |
| InChIKey | RVKJTYZLNJLFKB-FJXFTSETSA-N |
| XLogP | 7.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.75 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|