C15H31NO2Sn — CID 14492456
[(Z)-4-trimethylstannylpent-2-en-2-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 14492456) has the molecular formula C15H31NO2Sn and a molecular weight of 376.13 g/mol. Its IUPAC name is [(Z)-4-trimethylstannylpent-2-en-2-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z)-4-trimethylstannylpent-2-en-2-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 14492456 |
| Molecular Formula | C15H31NO2Sn |
| Molecular Weight | 376.13 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [(Z)-4-trimethylstannylpent-2-en-2-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | C/C(=C/C(C)[Sn](C)(C)C)OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C12H22NO2.3CH3.Sn/c1-7-8-11(6)15-12(14)13(9(2)3)10(4)5;;;;/h7-10H,1-6H3;3*1H3;/b11-8-;;;; |
| InChIKey | XZRMUAVNPSKDFK-KNBWSUOLSA-N |
| XLogP | 4.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.13 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|