C13H25NO — CID 101053961
(Z,2S)-2,3-dimethyl-N,N-di(propan-2-yl)pent-3-enamide (PubChem CID 101053961) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (Z,2S)-2,3-dimethyl-N,N-di(propan-2-yl)pent-3-enamide.
| Compound Name | (Z,2S)-2,3-dimethyl-N,N-di(propan-2-yl)pent-3-enamide |
|---|---|
| PubChem CID | 101053961 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (Z,2S)-2,3-dimethyl-N,N-di(propan-2-yl)pent-3-enamide |
| SMILES | C/C=C(/C)[C@H](C)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C13H25NO/c1-8-11(6)12(7)13(15)14(9(2)3)10(4)5/h8-10,12H,1-7H3/b11-8-/t12-/m0/s1 |
| InChIKey | GVLAIFIUTCGAPO-KGTBHZDVSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|