About (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene
(5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene (PubChem CID 146393008) has the molecular formula C10H17Cl
and a molecular weight of 172.70 g/mol. Its IUPAC name is (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene.
Molecular Properties
| Compound Name | (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene |
| PubChem CID | 146393008 |
| Molecular Formula | C10H17Cl |
| Molecular Weight | 172.70 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene |
| SMILES | C/C=C(\C)C(C)C(Cl)=C(C)C |
| InChI | InChI=1S/C10H17Cl/c1-6-8(4)9(5)10(11)7(2)3/h6,9H,1-5H3/b8-6+ |
| InChIKey | NENDOJZZMQVSPW-SOFGYWHQSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.70 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene?
The IUPAC name of (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene (CID 146393008) is (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene.
What is the SMILES notation for (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene?
The canonical SMILES for (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene is C/C=C(\C)C(C)C(Cl)=C(C)C.
What is the InChIKey of (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene?
The InChIKey is NENDOJZZMQVSPW-SOFGYWHQSA-N. The full InChI is InChI=1S/C10H17Cl/c1-6-8(4)9(5)10(11)7(2)3/h6,9H,1-5H3/b8-6+.
What are the key properties of (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene?
(5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene has a molecular weight of 172.70 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene is sourced from PubChem (CID 146393008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).