C10H17Cl — CID 146393008
(5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene (PubChem CID 146393008) has the molecular formula C10H17Cl and a molecular weight of 172.70 g/mol. Its IUPAC name is (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene.
| Compound Name | (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene |
|---|---|
| PubChem CID | 146393008 |
| Molecular Formula | C10H17Cl |
| Molecular Weight | 172.70 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (5E)-3-chloro-2,4,5-trimethylhepta-2,5-diene |
| SMILES | C/C=C(\C)C(C)C(Cl)=C(C)C |
| InChI | InChI=1S/C10H17Cl/c1-6-8(4)9(5)10(11)7(2)3/h6,9H,1-5H3/b8-6+ |
| InChIKey | NENDOJZZMQVSPW-SOFGYWHQSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.70 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|