C15H27NO2 — CID 101381446
[(Z)-1-[(1S)-2,2-dimethylcyclopropyl]prop-1-en-2-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 101381446) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is [(Z)-1-[(1S)-2,2-dimethylcyclopropyl]prop-1-en-2-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z)-1-[(1S)-2,2-dimethylcyclopropyl]prop-1-en-2-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 101381446 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | [(Z)-1-[(1S)-2,2-dimethylcyclopropyl]prop-1-en-2-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | C/C(=C/[C@@H]1CC1(C)C)OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H27NO2/c1-10(2)16(11(3)4)14(17)18-12(5)8-13-9-15(13,6)7/h8,10-11,13H,9H2,1-7H3/b12-8-/t13-/m1/s1 |
| InChIKey | QPQWMYZEFSGKNK-LLBKUYECSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|