C17H33NO2Sn — CID 177428027
[(E)-2-[(1S)-2,2-dimethylcyclopropyl]-1-trimethylstannylethenyl] N,N-di(propan-2-yl)carbamate (PubChem CID 177428027) has the molecular formula C17H33NO2Sn and a molecular weight of 402.17 g/mol. Its IUPAC name is [(E)-2-[(1S)-2,2-dimethylcyclopropyl]-1-trimethylstannylethenyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(E)-2-[(1S)-2,2-dimethylcyclopropyl]-1-trimethylstannylethenyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 177428027 |
| Molecular Formula | C17H33NO2Sn |
| Molecular Weight | 402.17 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [(E)-2-[(1S)-2,2-dimethylcyclopropyl]-1-trimethylstannylethenyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O/C(=C\[C@@H]1CC1(C)C)[Sn](C)(C)C)C(C)C |
| InChI | InChI=1S/C14H24NO2.3CH3.Sn/c1-10(2)15(11(3)4)13(16)17-8-7-12-9-14(12,5)6;;;;/h7,10-12H,9H2,1-6H3;3*1H3;/t12-;;;;/m1..../s1 |
| InChIKey | TZROGKVNOPUZED-HHUWXINPSA-N |
| XLogP | 5.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.17 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|