C18H37NO3Si — CID 101343519
[(Z,3S,4R)-4-hydroxy-3-methyl-1-trimethylsilylhept-1-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 101343519) has the molecular formula C18H37NO3Si and a molecular weight of 343.58 g/mol. Its IUPAC name is [(Z,3S,4R)-4-hydroxy-3-methyl-1-trimethylsilylhept-1-enyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z,3S,4R)-4-hydroxy-3-methyl-1-trimethylsilylhept-1-enyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 101343519 |
| Molecular Formula | C18H37NO3Si |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | [(Z,3S,4R)-4-hydroxy-3-methyl-1-trimethylsilylhept-1-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CCC[C@@H](O)[C@@H](C)/C=C(/OC(=O)N(C(C)C)C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H37NO3Si/c1-10-11-16(20)15(6)12-17(23(7,8)9)22-18(21)19(13(2)3)14(4)5/h12-16,20H,10-11H2,1-9H3/b17-12-/t15-,16+/m0/s1 |
| InChIKey | NTBZJQPWKYPMAI-NHMNYBGFSA-N |
| XLogP | 4.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|