C15H30N2O — CID 89154039
(Z)-6-amino-2,2-dimethyl-N,N-di(propan-2-yl)hept-3-enamide (PubChem CID 89154039) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is (Z)-6-amino-2,2-dimethyl-N,N-di(propan-2-yl)hept-3-enamide.
| Compound Name | (Z)-6-amino-2,2-dimethyl-N,N-di(propan-2-yl)hept-3-enamide |
|---|---|
| PubChem CID | 89154039 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | (Z)-6-amino-2,2-dimethyl-N,N-di(propan-2-yl)hept-3-enamide |
| SMILES | CC(N)C/C=C\C(C)(C)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H30N2O/c1-11(2)17(12(3)4)14(18)15(6,7)10-8-9-13(5)16/h8,10-13H,9,16H2,1-7H3/b10-8- |
| InChIKey | XWZXFDFTNBRALT-NTMALXAHSA-N |
| XLogP | 2.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|