About 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate
2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate (PubChem CID 102466999) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate |
| PubChem CID | 102466999 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate |
| SMILES | C=CC(C)(C)OC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C10H19NO2/c1-6-10(4,5)13-9(12)8(11)7(2)3/h6-8H,1,11H2,2-5H3/t8-/m0/s1 |
| InChIKey | QIVKOSZBEVWUAA-QMMMGPOBSA-N |
| XLogP | 1.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate?
The IUPAC name of 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate (CID 102466999) is 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate.
What is the SMILES notation for 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate?
The canonical SMILES for 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate is C=CC(C)(C)OC(=O)[C@@H](N)C(C)C.
What is the InChIKey of 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate?
The InChIKey is QIVKOSZBEVWUAA-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H19NO2/c1-6-10(4,5)13-9(12)8(11)7(2)3/h6-8H,1,11H2,2-5H3/t8-/m0/s1.
What are the key properties of 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate?
2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate has a molecular weight of 185.27 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-3-en-2-yl (2S)-2-amino-3-methylbutanoate is sourced from PubChem (CID 102466999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).