About 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate
2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate (PubChem CID 139681730) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate |
| PubChem CID | 139681730 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate |
| SMILES | CCC(C)(N)OC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C9H20N2O2/c1-5-9(4,11)13-8(12)7(10)6(2)3/h6-7H,5,10-11H2,1-4H3/t7-,9?/m0/s1 |
| InChIKey | NPAWBRNJBLGZSS-JAVCKPHESA-N |
| XLogP | 0.60 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate?
The IUPAC name of 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate (CID 139681730) is 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate.
What is the SMILES notation for 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate?
The canonical SMILES for 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate is CCC(C)(N)OC(=O)[C@@H](N)C(C)C.
What is the InChIKey of 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate?
The InChIKey is NPAWBRNJBLGZSS-JAVCKPHESA-N. The full InChI is InChI=1S/C9H20N2O2/c1-5-9(4,11)13-8(12)7(10)6(2)3/h6-7H,5,10-11H2,1-4H3/t7-,9?/m0/s1.
What are the key properties of 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate?
2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate has a molecular weight of 188.27 g/mol, XLogP of 0.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutan-2-yl (2S)-2-amino-3-methylbutanoate is sourced from PubChem (CID 139681730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).