C15H30N2O5 — CID 137495012
[4-[2-(hydroxymethylamino)acetyl]oxy-2,4-dimethylpentan-2-yl] 2-amino-3-methylbutanoate (PubChem CID 137495012) has the molecular formula C15H30N2O5 and a molecular weight of 318.41 g/mol. Its IUPAC name is [4-[2-(hydroxymethylamino)acetyl]oxy-2,4-dimethylpentan-2-yl] 2-amino-3-methylbutanoate.
| Compound Name | [4-[2-(hydroxymethylamino)acetyl]oxy-2,4-dimethylpentan-2-yl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 137495012 |
| Molecular Formula | C15H30N2O5 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [4-[2-(hydroxymethylamino)acetyl]oxy-2,4-dimethylpentan-2-yl] 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)OC(C)(C)CC(C)(C)OC(=O)CNCO |
| InChI | InChI=1S/C15H30N2O5/c1-10(2)12(16)13(20)22-15(5,6)8-14(3,4)21-11(19)7-17-9-18/h10,12,17-18H,7-9,16H2,1-6H3 |
| InChIKey | YNYCUQDYWWROEW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|