C17H33NO4 — CID 123591285
N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate (PubChem CID 123591285) has the molecular formula C17H33NO4 and a molecular weight of 315.45 g/mol. Its IUPAC name is N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate.
| Compound Name | N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 123591285 |
| Molecular Formula | C17H33NO4 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate |
| SMILES | C=CCOCCOC(=O)C(C)(C)CC.CCC(C)NC(C)=O |
| InChI | InChI=1S/C11H20O3.C6H13NO/c1-5-7-13-8-9-14-10(12)11(3,4)6-2;1-4-5(2)7-6(3)8/h5H,1,6-9H2,2-4H3;5H,4H2,1-3H3,(H,7,8) |
| InChIKey | DDZLZFOBYRKELP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|