About N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate
N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate (PubChem CID 123591285) has the molecular formula C17H33NO4
and a molecular weight of 315.45 g/mol. Its IUPAC name is N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate |
| PubChem CID | 123591285 |
| Molecular Formula | C17H33NO4 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate |
| SMILES | C=CCOCCOC(=O)C(C)(C)CC.CCC(C)NC(C)=O |
| InChI | InChI=1S/C11H20O3.C6H13NO/c1-5-7-13-8-9-14-10(12)11(3,4)6-2;1-4-5(2)7-6(3)8/h5H,1,6-9H2,2-4H3;5H,4H2,1-3H3,(H,7,8) |
| InChIKey | DDZLZFOBYRKELP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate?
The IUPAC name of N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate (CID 123591285) is N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate.
What is the SMILES notation for N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate?
The canonical SMILES for N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate is C=CCOCCOC(=O)C(C)(C)CC.CCC(C)NC(C)=O.
What is the InChIKey of N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate?
The InChIKey is DDZLZFOBYRKELP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3.C6H13NO/c1-5-7-13-8-9-14-10(12)11(3,4)6-2;1-4-5(2)7-6(3)8/h5H,1,6-9H2,2-4H3;5H,4H2,1-3H3,(H,7,8).
What are the key properties of N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate?
N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate has a molecular weight of 315.45 g/mol, XLogP of 3.09, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-ylacetamide;2-prop-2-enoxyethyl 2,2-dimethylbutanoate is sourced from PubChem (CID 123591285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).