C25H49NO7 — CID 161196446
methyl 2,2-dimethylbutanoate;2-prop-2-enylperoxyethyl 2,2-dimethylbutanoate;N,N,2-trimethylbutanamide (PubChem CID 161196446) has the molecular formula C25H49NO7 and a molecular weight of 475.67 g/mol. Its IUPAC name is methyl 2,2-dimethylbutanoate;2-prop-2-enylperoxyethyl 2,2-dimethylbutanoate;N,N,2-trimethylbutanamide.
| Compound Name | methyl 2,2-dimethylbutanoate;2-prop-2-enylperoxyethyl 2,2-dimethylbutanoate;N,N,2-trimethylbutanamide |
|---|---|
| PubChem CID | 161196446 |
| Molecular Formula | C25H49NO7 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.35 |
| IUPAC Name | methyl 2,2-dimethylbutanoate;2-prop-2-enylperoxyethyl 2,2-dimethylbutanoate;N,N,2-trimethylbutanamide |
| SMILES | C=CCOOCCOC(=O)C(C)(C)CC.CCC(C)(C)C(=O)OC.CCC(C)C(=O)N(C)C |
| InChI | InChI=1S/C11H20O4.C7H15NO.C7H14O2/c1-5-7-14-15-9-8-13-10(12)11(3,4)6-2;1-5-6(2)7(9)8(3)4;1-5-7(2,3)6(8)9-4/h5H,1,6-9H2,2-4H3;6H,5H2,1-4H3;5H2,1-4H3 |
| InChIKey | UUKFBBFRPUASOF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|