C13H22F2O7S — CID 163841251
2-[2-(2,2-dimethylbutanoyloxy)-3-oxopentan-2-yl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 163841251) has the molecular formula C13H22F2O7S and a molecular weight of 360.38 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylbutanoyloxy)-3-oxopentan-2-yl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[2-(2,2-dimethylbutanoyloxy)-3-oxopentan-2-yl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 163841251 |
| Molecular Formula | C13H22F2O7S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-[2-(2,2-dimethylbutanoyloxy)-3-oxopentan-2-yl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CCC(=O)C(C)(OCC(F)(F)S(=O)(=O)O)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C13H22F2O7S/c1-6-9(16)12(5,22-10(17)11(3,4)7-2)21-8-13(14,15)23(18,19)20/h6-8H2,1-5H3,(H,18,19,20) |
| InChIKey | JVFIQXYPJVGRRJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|