C18H35O8S- — CID 157454900
4-[2-(2,2-dimethylbutanoyloxy)-1-methoxy-1-oxopropan-2-yl]oxy-2,3,3-trimethylbutane-2-sulfonate;methane (PubChem CID 157454900) has the molecular formula C18H35O8S- and a molecular weight of 411.54 g/mol. Its IUPAC name is 4-[2-(2,2-dimethylbutanoyloxy)-1-methoxy-1-oxopropan-2-yl]oxy-2,3,3-trimethylbutane-2-sulfonate;methane.
| Compound Name | 4-[2-(2,2-dimethylbutanoyloxy)-1-methoxy-1-oxopropan-2-yl]oxy-2,3,3-trimethylbutane-2-sulfonate;methane |
|---|---|
| PubChem CID | 157454900 |
| Molecular Formula | C18H35O8S- |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 4-[2-(2,2-dimethylbutanoyloxy)-1-methoxy-1-oxopropan-2-yl]oxy-2,3,3-trimethylbutane-2-sulfonate;methane |
| SMILES | C.CCC(C)(C)C(=O)OC(C)(OCC(C)(C)C(C)(C)S(=O)(=O)[O-])C(=O)OC |
| InChI | InChI=1S/C17H32O8S.CH4/c1-10-14(2,3)12(18)25-17(8,13(19)23-9)24-11-15(4,5)16(6,7)26(20,21)22;/h10-11H2,1-9H3,(H,20,21,22);1H4/p-1 |
| InChIKey | BTFXFDSOIXMWAV-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|