C16H33O2+ — CID 91036824
methyl 2,2-dimethylbutanoate;2,3,3-trimethyl-2-methylpentane (PubChem CID 91036824) has the molecular formula C16H33O2+ and a molecular weight of 257.44 g/mol. Its IUPAC name is methyl 2,2-dimethylbutanoate;2,3,3-trimethyl-2-methylpentane.
| Compound Name | methyl 2,2-dimethylbutanoate;2,3,3-trimethyl-2-methylpentane |
|---|---|
| PubChem CID | 91036824 |
| Molecular Formula | C16H33O2+ |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | methyl 2,2-dimethylbutanoate;2,3,3-trimethyl-2-methylpentane |
| SMILES | CCC(C)(C)C(=O)OC.[CH2+]C(C)(C)C(C)(C)CC |
| InChI | InChI=1S/C9H19.C7H14O2/c1-7-9(5,6)8(2,3)4;1-5-7(2,3)6(8)9-4/h2,7H2,1,3-6H3;5H2,1-4H3/q+1; |
| InChIKey | BYCQGAJCDZSRFM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|