C13H24O4S — CID 59269951
(3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylmethyl 2,2-dimethylbutanoate (PubChem CID 59269951) has the molecular formula C13H24O4S and a molecular weight of 276.40 g/mol. Its IUPAC name is (3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylmethyl 2,2-dimethylbutanoate.
| Compound Name | (3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylmethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59269951 |
| Molecular Formula | C13H24O4S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylmethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCSCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C13H24O4S/c1-7-12(2,3)11(15)17-9-18-8-13(4,5)10(14)16-6/h7-9H2,1-6H3 |
| InChIKey | QQDKBLQRHZILGC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|