C17H18F8O5S — CID 170532228
[2-[[3,5-bis(trifluoromethyl)phenyl]methoxysulfonyl]-2,2-difluoroethyl] 2,2-dimethylbutanoate (PubChem CID 170532228) has the molecular formula C17H18F8O5S and a molecular weight of 486.38 g/mol. Its IUPAC name is [2-[[3,5-bis(trifluoromethyl)phenyl]methoxysulfonyl]-2,2-difluoroethyl] 2,2-dimethylbutanoate.
| Compound Name | [2-[[3,5-bis(trifluoromethyl)phenyl]methoxysulfonyl]-2,2-difluoroethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 170532228 |
| Molecular Formula | C17H18F8O5S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | [2-[[3,5-bis(trifluoromethyl)phenyl]methoxysulfonyl]-2,2-difluoroethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(F)(F)S(=O)(=O)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F8O5S/c1-4-14(2,3)13(26)29-9-15(18,19)31(27,28)30-8-10-5-11(16(20,21)22)7-12(6-10)17(23,24)25/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | MIZYXXUPHKPKJL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|