C10H21O6P — CID 88616081
(1-ethoxy-3-ethyl-2-hydroxy-3-methyl-1-oxopentan-2-yl)phosphonic acid (PubChem CID 88616081) has the molecular formula C10H21O6P and a molecular weight of 268.25 g/mol. Its IUPAC name is (1-ethoxy-3-ethyl-2-hydroxy-3-methyl-1-oxopentan-2-yl)phosphonic acid.
| Compound Name | (1-ethoxy-3-ethyl-2-hydroxy-3-methyl-1-oxopentan-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 88616081 |
| Molecular Formula | C10H21O6P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (1-ethoxy-3-ethyl-2-hydroxy-3-methyl-1-oxopentan-2-yl)phosphonic acid |
| SMILES | CCOC(=O)C(O)(C(C)(CC)CC)P(=O)(O)O |
| InChI | InChI=1S/C10H21O6P/c1-5-9(4,6-2)10(12,17(13,14)15)8(11)16-7-3/h12H,5-7H2,1-4H3,(H2,13,14,15) |
| InChIKey | AMNBGFLPAGVWRL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|