About (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid
(2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid (PubChem CID 87331725) has the molecular formula C6H13O7P
and a molecular weight of 228.14 g/mol. Its IUPAC name is (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid.
Molecular Properties
| Compound Name | (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid |
| PubChem CID | 87331725 |
| Molecular Formula | C6H13O7P |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid |
| SMILES | CCOC(=O)C(OC)(OC)P(=O)(O)O |
| InChI | InChI=1S/C6H13O7P/c1-4-13-5(7)6(11-2,12-3)14(8,9)10/h4H2,1-3H3,(H2,8,9,10) |
| InChIKey | SUFKEQLJJSRPGS-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid?
The IUPAC name of (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid (CID 87331725) is (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid.
What is the SMILES notation for (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid?
The canonical SMILES for (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid is CCOC(=O)C(OC)(OC)P(=O)(O)O.
What is the InChIKey of (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid?
The InChIKey is SUFKEQLJJSRPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O7P/c1-4-13-5(7)6(11-2,12-3)14(8,9)10/h4H2,1-3H3,(H2,8,9,10).
What are the key properties of (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid?
(2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid has a molecular weight of 228.14 g/mol, XLogP of -0.33, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-1,1-dimethoxy-2-oxoethyl)phosphonic acid is sourced from PubChem (CID 87331725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).