C8H16NO6P — CID 54044871
[(4S)-4-amino-5-ethoxy-4-methyl-2,5-dioxopentyl]phosphonic acid (PubChem CID 54044871) has the molecular formula C8H16NO6P and a molecular weight of 253.19 g/mol. Its IUPAC name is [(4S)-4-amino-5-ethoxy-4-methyl-2,5-dioxopentyl]phosphonic acid.
| Compound Name | [(4S)-4-amino-5-ethoxy-4-methyl-2,5-dioxopentyl]phosphonic acid |
|---|---|
| PubChem CID | 54044871 |
| Molecular Formula | C8H16NO6P |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | [(4S)-4-amino-5-ethoxy-4-methyl-2,5-dioxopentyl]phosphonic acid |
| SMILES | CCOC(=O)[C@@](C)(N)CC(=O)CP(=O)(O)O |
| InChI | InChI=1S/C8H16NO6P/c1-3-15-7(11)8(2,9)4-6(10)5-16(12,13)14/h3-5,9H2,1-2H3,(H2,12,13,14)/t8-/m0/s1 |
| InChIKey | LOVWCIWDGTTXSN-QMMMGPOBSA-N |
| XLogP | -0.60 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|