C9H13F6O5P — CID 87798162
[1-ethoxy-5,5,5-trifluoro-2-methyl-1-oxo-3-(trifluoromethyl)pentan-2-yl]phosphonic acid (PubChem CID 87798162) has the molecular formula C9H13F6O5P and a molecular weight of 346.16 g/mol. Its IUPAC name is [1-ethoxy-5,5,5-trifluoro-2-methyl-1-oxo-3-(trifluoromethyl)pentan-2-yl]phosphonic acid.
| Compound Name | [1-ethoxy-5,5,5-trifluoro-2-methyl-1-oxo-3-(trifluoromethyl)pentan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 87798162 |
| Molecular Formula | C9H13F6O5P |
| Molecular Weight | 346.16 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | [1-ethoxy-5,5,5-trifluoro-2-methyl-1-oxo-3-(trifluoromethyl)pentan-2-yl]phosphonic acid |
| SMILES | CCOC(=O)C(C)(C(CC(F)(F)F)C(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C9H13F6O5P/c1-3-20-6(16)7(2,21(17,18)19)5(9(13,14)15)4-8(10,11)12/h5H,3-4H2,1-2H3,(H2,17,18,19) |
| InChIKey | VKGWDQIIYNPIPS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|