C10H18F2O3 — CID 62398575
ethyl 2,2-difluoro-3-hydroxy-3,5-dimethylhexanoate (PubChem CID 62398575) has the molecular formula C10H18F2O3 and a molecular weight of 224.25 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-hydroxy-3,5-dimethylhexanoate.
| Compound Name | ethyl 2,2-difluoro-3-hydroxy-3,5-dimethylhexanoate |
|---|---|
| PubChem CID | 62398575 |
| Molecular Formula | C10H18F2O3 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | ethyl 2,2-difluoro-3-hydroxy-3,5-dimethylhexanoate |
| SMILES | CCOC(=O)C(F)(F)C(C)(O)CC(C)C |
| InChI | InChI=1S/C10H18F2O3/c1-5-15-8(13)10(11,12)9(4,14)6-7(2)3/h7,14H,5-6H2,1-4H3 |
| InChIKey | UMVYDXKBPPIIJY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |