C13H27NO — CID 143920647
2-(2,2-dimethylpropyl)-3,3-dimethylhexanamide (PubChem CID 143920647) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-3,3-dimethylhexanamide.
| Compound Name | 2-(2,2-dimethylpropyl)-3,3-dimethylhexanamide |
|---|---|
| PubChem CID | 143920647 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-3,3-dimethylhexanamide |
| SMILES | CCCC(C)(C)C(CC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C13H27NO/c1-7-8-13(5,6)10(11(14)15)9-12(2,3)4/h10H,7-9H2,1-6H3,(H2,14,15) |
| InChIKey | FQOYGBWHJYZQFO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |