C15H32 — CID 123538800
2,2,4,5,6,6-hexamethylnonane (PubChem CID 123538800) has the molecular formula C15H32 and a molecular weight of 212.42 g/mol. Its IUPAC name is 2,2,4,5,6,6-hexamethylnonane.
| Compound Name | 2,2,4,5,6,6-hexamethylnonane |
|---|---|
| PubChem CID | 123538800 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 2,2,4,5,6,6-hexamethylnonane |
| SMILES | CCCC(C)(C)C(C)C(C)CC(C)(C)C |
| InChI | InChI=1S/C15H32/c1-9-10-15(7,8)13(3)12(2)11-14(4,5)6/h12-13H,9-11H2,1-8H3 |
| InChIKey | CPFOPENARQNNHD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |