C24H44O6 — CID 140808581
[3,5,5-trimethyl-2-(2-methylpentan-2-yl)hexanoyl] 3-(4,4-dimethylpentan-2-yl)dioxirane-3-carboperoxoate (PubChem CID 140808581) has the molecular formula C24H44O6 and a molecular weight of 428.61 g/mol. Its IUPAC name is [3,5,5-trimethyl-2-(2-methylpentan-2-yl)hexanoyl] 3-(4,4-dimethylpentan-2-yl)dioxirane-3-carboperoxoate.
| Compound Name | [3,5,5-trimethyl-2-(2-methylpentan-2-yl)hexanoyl] 3-(4,4-dimethylpentan-2-yl)dioxirane-3-carboperoxoate |
|---|---|
| PubChem CID | 140808581 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | [3,5,5-trimethyl-2-(2-methylpentan-2-yl)hexanoyl] 3-(4,4-dimethylpentan-2-yl)dioxirane-3-carboperoxoate |
| SMILES | CCCC(C)(C)C(C(=O)OOC(=O)C1(C(C)CC(C)(C)C)OO1)C(C)CC(C)(C)C |
| InChI | InChI=1S/C24H44O6/c1-12-13-23(10,11)18(16(2)14-21(4,5)6)19(25)27-28-20(26)24(29-30-24)17(3)15-22(7,8)9/h16-18H,12-15H2,1-11H3 |
| InChIKey | SARDHVBAPHHQHX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|