C16H32O2 — CID 123269776
ethyl 3,5,5-trimethyl-2-(2-methylbutan-2-yl)hexanoate (PubChem CID 123269776) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is ethyl 3,5,5-trimethyl-2-(2-methylbutan-2-yl)hexanoate.
| Compound Name | ethyl 3,5,5-trimethyl-2-(2-methylbutan-2-yl)hexanoate |
|---|---|
| PubChem CID | 123269776 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | ethyl 3,5,5-trimethyl-2-(2-methylbutan-2-yl)hexanoate |
| SMILES | CCOC(=O)C(C(C)CC(C)(C)C)C(C)(C)CC |
| InChI | InChI=1S/C16H32O2/c1-9-16(7,8)13(14(17)18-10-2)12(3)11-15(4,5)6/h12-13H,9-11H2,1-8H3 |
| InChIKey | XZBZVHFMOJFOCM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |