C14H27ClO2 — CID 87162930
3-ethoxy-4,4-dimethyl-2-(2-methylbutan-2-yl)pentanoyl chloride (PubChem CID 87162930) has the molecular formula C14H27ClO2 and a molecular weight of 262.82 g/mol. Its IUPAC name is 3-ethoxy-4,4-dimethyl-2-(2-methylbutan-2-yl)pentanoyl chloride.
| Compound Name | 3-ethoxy-4,4-dimethyl-2-(2-methylbutan-2-yl)pentanoyl chloride |
|---|---|
| PubChem CID | 87162930 |
| Molecular Formula | C14H27ClO2 |
| Molecular Weight | 262.82 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-ethoxy-4,4-dimethyl-2-(2-methylbutan-2-yl)pentanoyl chloride |
| SMILES | CCOC(C(C(=O)Cl)C(C)(C)CC)C(C)(C)C |
| InChI | InChI=1S/C14H27ClO2/c1-8-14(6,7)10(12(15)16)11(17-9-2)13(3,4)5/h10-11H,8-9H2,1-7H3 |
| InChIKey | YNTUAQRJFZEGFD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|