C12H24O5 — CID 66038601
ethyl 3-hydroxy-4,4-dimethoxy-3-methyl-2-propan-2-ylbutanoate (PubChem CID 66038601) has the molecular formula C12H24O5 and a molecular weight of 248.32 g/mol. Its IUPAC name is ethyl 3-hydroxy-4,4-dimethoxy-3-methyl-2-propan-2-ylbutanoate.
| Compound Name | ethyl 3-hydroxy-4,4-dimethoxy-3-methyl-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 66038601 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | ethyl 3-hydroxy-4,4-dimethoxy-3-methyl-2-propan-2-ylbutanoate |
| SMILES | CCOC(=O)C(C(C)C)C(C)(O)C(OC)OC |
| InChI | InChI=1S/C12H24O5/c1-7-17-10(13)9(8(2)3)12(4,14)11(15-5)16-6/h8-9,11,14H,7H2,1-6H3 |
| InChIKey | DXXZPXLDEVBBOU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|