C15H20F2O3 — CID 62397972
ethyl 3-(2,6-difluorophenyl)-3-hydroxy-2-propan-2-ylbutanoate (PubChem CID 62397972) has the molecular formula C15H20F2O3 and a molecular weight of 286.32 g/mol. Its IUPAC name is ethyl 3-(2,6-difluorophenyl)-3-hydroxy-2-propan-2-ylbutanoate.
| Compound Name | ethyl 3-(2,6-difluorophenyl)-3-hydroxy-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 62397972 |
| Molecular Formula | C15H20F2O3 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 3-(2,6-difluorophenyl)-3-hydroxy-2-propan-2-ylbutanoate |
| SMILES | CCOC(=O)C(C(C)C)C(C)(O)c1c(F)cccc1F |
| InChI | InChI=1S/C15H20F2O3/c1-5-20-14(18)12(9(2)3)15(4,19)13-10(16)7-6-8-11(13)17/h6-9,12,19H,5H2,1-4H3 |
| InChIKey | ZKGBSWFOOGDZOT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |