About ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate
ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate (PubChem CID 62398794) has the molecular formula C14H18F2O3
and a molecular weight of 272.29 g/mol. Its IUPAC name is ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate.
Analyze ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate?
The IUPAC name of ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate (CID 62398794) is ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate.
What is the SMILES notation for ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate?
The canonical SMILES for ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate is CCOC(=O)C(C(C)C)C(O)c1c(F)cccc1F.
What is the InChIKey of ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate?
The InChIKey is CNAHRLKDOKXUNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2O3/c1-4-19-14(18)11(8(2)3)13(17)12-9(15)6-5-7-10(12)16/h5-8,11,13,17H,4H2,1-3H3.
What are the key properties of ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate?
ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate has a molecular weight of 272.29 g/mol, XLogP of 2.83, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2,6-difluorophenyl)-hydroxymethyl]-3-methylbutanoate is sourced from PubChem (CID 62398794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).