C13H16F2O3 — CID 62397035
3-(2,6-difluorophenyl)-3-hydroxy-2-propan-2-ylbutanoic acid (PubChem CID 62397035) has the molecular formula C13H16F2O3 and a molecular weight of 258.26 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-3-hydroxy-2-propan-2-ylbutanoic acid.
| Compound Name | 3-(2,6-difluorophenyl)-3-hydroxy-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 62397035 |
| Molecular Formula | C13H16F2O3 |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-(2,6-difluorophenyl)-3-hydroxy-2-propan-2-ylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)C(C)(O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H16F2O3/c1-7(2)10(12(16)17)13(3,18)11-8(14)5-4-6-9(11)15/h4-7,10,18H,1-3H3,(H,16,17) |
| InChIKey | GTSVIPVDWTUMMZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |