C15H22O3 — CID 62398844
3-(2,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoic acid (PubChem CID 62398844) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoic acid.
| Compound Name | 3-(2,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 62398844 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoic acid |
| SMILES | Cc1ccc(C(C)(O)C(C(=O)O)C(C)C)c(C)c1 |
| InChI | InChI=1S/C15H22O3/c1-9(2)13(14(16)17)15(5,18)12-7-6-10(3)8-11(12)4/h6-9,13,18H,1-5H3,(H,16,17) |
| InChIKey | ZFXVSVLXZFUYCJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |